C19H20N2O4S2 — CID 7523844
N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methylsulfonylbenzamide (PubChem CID 7523844) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methylsulfonylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 7523844 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methylsulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(C)(=O)=O)cc2)sc2ccccc21 |
| InChI | InChI=1S/C19H20N2O4S2/c1-3-25-13-12-21-16-6-4-5-7-17(16)26-19(21)20-18(22)14-8-10-15(11-9-14)27(2,23)24/h4-11H,3,12-13H2,1-2H3/b20-19- |
| InChIKey | VFXOJKBZSJLCGS-VXPUYCOJSA-N |
| XLogP | 2.88 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|