C19H18F2N2O4S2 — CID 4095095
N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-2,6-difluorobenzamide (PubChem CID 4095095) has the molecular formula C19H18F2N2O4S2 and a molecular weight of 440.49 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-2,6-difluorobenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 4095095 |
| Molecular Formula | C19H18F2N2O4S2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-2,6-difluorobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2c(F)cccc2F)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H18F2N2O4S2/c1-3-27-10-9-23-15-8-7-12(29(2,25)26)11-16(15)28-19(23)22-18(24)17-13(20)5-4-6-14(17)21/h4-8,11H,3,9-10H2,1-2H3/b22-19- |
| InChIKey | SUHQZEDHOGTGEO-QOCHGBHMSA-N |
| XLogP | 3.16 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|