C18H14F2N2O3S2 — CID 4127507
2,6-difluoro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4127507) has the molecular formula C18H14F2N2O3S2 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2,6-difluoro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,6-difluoro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4127507 |
| Molecular Formula | C18H14F2N2O3S2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2,6-difluoro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2c(F)cccc2F)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H14F2N2O3S2/c1-3-9-22-14-8-7-11(27(2,24)25)10-15(14)26-18(22)21-17(23)16-12(19)5-4-6-13(16)20/h3-8,10H,1,9H2,2H3/b21-18- |
| InChIKey | NKFCNEWTQGWFLR-UZYVYHOESA-N |
| XLogP | 3.31 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|