C17H15ClN2O4S3 — CID 40892067
4-chloro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide (PubChem CID 40892067) has the molecular formula C17H15ClN2O4S3 and a molecular weight of 442.97 g/mol. Its IUPAC name is 4-chloro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide.
| Compound Name | 4-chloro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 40892067 |
| Molecular Formula | C17H15ClN2O4S3 |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 4-chloro-N-(6-methylsulfonyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2ccc(Cl)cc2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H15ClN2O4S3/c1-3-10-20-15-9-8-14(26(2,21)22)11-16(15)25-17(20)19-27(23,24)13-6-4-12(18)5-7-13/h3-9,11H,1,10H2,2H3 |
| InChIKey | ZWLLIMCGVXXCOM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|