C18H17ClN2O4S2 — CID 16937745
(NZ)-4-chloro-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide (PubChem CID 16937745) has the molecular formula C18H17ClN2O4S2 and a molecular weight of 424.93 g/mol. Its IUPAC name is (NZ)-4-chloro-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide.
| Compound Name | (NZ)-4-chloro-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 16937745 |
| Molecular Formula | C18H17ClN2O4S2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | (NZ)-4-chloro-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
| SMILES | C=CCn1/c(=N/S(=O)(=O)c2ccc(Cl)cc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C18H17ClN2O4S2/c1-4-9-21-14-10-15(24-2)16(25-3)11-17(14)26-18(21)20-27(22,23)13-7-5-12(19)6-8-13/h4-8,10-11H,1,9H2,2-3H3/b20-18- |
| InChIKey | MEFXQIUMZXBDDL-ZZEZOPTASA-N |
| XLogP | 3.85 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|