C16H16N2O4S3 — CID 40892487
N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 40892487) has the molecular formula C16H16N2O4S3 and a molecular weight of 396.52 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892487 |
| Molecular Formula | C16H16N2O4S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2cccs2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C16H16N2O4S3/c1-4-7-18-11-9-12(21-2)13(22-3)10-14(11)24-16(18)17-25(19,20)15-6-5-8-23-15/h4-6,8-10H,1,7H2,2-3H3 |
| InChIKey | HQGRFZNWJJZPFA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|