C14H11ClN2O2S3 — CID 40892427
N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 40892427) has the molecular formula C14H11ClN2O2S3 and a molecular weight of 370.91 g/mol. Its IUPAC name is N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892427 |
| Molecular Formula | C14H11ClN2O2S3 |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2cccs2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H11ClN2O2S3/c1-2-7-17-11-6-5-10(15)9-12(11)21-14(17)16-22(18,19)13-4-3-8-20-13/h2-6,8-9H,1,7H2 |
| InChIKey | WJLNEISDCHIDQC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|