C16H15ClN2O3S3 — CID 16841667
(NZ)-5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 16841667) has the molecular formula C16H15ClN2O3S3 and a molecular weight of 414.96 g/mol. Its IUPAC name is (NZ)-5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | (NZ)-5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16841667 |
| Molecular Formula | C16H15ClN2O3S3 |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | (NZ)-5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCn1/c(=N/S(=O)(=O)c2ccc(Cl)s2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C16H15ClN2O3S3/c1-3-9-19-12-6-5-11(22-4-2)10-13(12)23-16(19)18-25(20,21)15-8-7-14(17)24-15/h3,5-8,10H,1,4,9H2,2H3/b18-16- |
| InChIKey | DEVDAEULEQRFPV-VLGSPTGOSA-N |
| XLogP | 4.29 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|