C17H19ClN2O4S3 — CID 40892570
5-chloro-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide (PubChem CID 40892570) has the molecular formula C17H19ClN2O4S3 and a molecular weight of 447.00 g/mol. Its IUPAC name is 5-chloro-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892570 |
| Molecular Formula | C17H19ClN2O4S3 |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 5-chloro-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C17H19ClN2O4S3/c1-3-23-10-9-20-13-6-5-12(24-4-2)11-14(13)25-17(20)19-27(21,22)16-8-7-15(18)26-16/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | WUFJPAUWOKJRMJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|