C15H16ClN3O5S4 — CID 40892566
2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-sulfonamide (PubChem CID 40892566) has the molecular formula C15H16ClN3O5S4 and a molecular weight of 482.03 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 40892566 |
| Molecular Formula | C15H16ClN3O5S4 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C15H16ClN3O5S4/c1-2-24-8-7-19-11-4-3-10(27(17,20)21)9-12(11)25-15(19)18-28(22,23)14-6-5-13(16)26-14/h3-6,9H,2,7-8H2,1H3,(H2,17,20,21) |
| InChIKey | WZZBWGWZJTUELX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|