C14H10ClN3O4S4 — CID 40892616
2-(5-chlorothiophen-2-yl)sulfonylimino-3-prop-2-ynyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 40892616) has the molecular formula C14H10ClN3O4S4 and a molecular weight of 447.97 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)sulfonylimino-3-prop-2-ynyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)sulfonylimino-3-prop-2-ynyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 40892616 |
| Molecular Formula | C14H10ClN3O4S4 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 446.92 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)sulfonylimino-3-prop-2-ynyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | C#CCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C14H10ClN3O4S4/c1-2-7-18-10-4-3-9(25(16,19)20)8-11(10)23-14(18)17-26(21,22)13-6-5-12(15)24-13/h1,3-6,8H,7H2,(H2,16,19,20) |
| InChIKey | DJDAJCLPKOBYIQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|