C15H9ClN2O4S3 — CID 40892639
5-chloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-sulfonamide (PubChem CID 40892639) has the molecular formula C15H9ClN2O4S3 and a molecular weight of 412.90 g/mol. Its IUPAC name is 5-chloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892639 |
| Molecular Formula | C15H9ClN2O4S3 |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | 5-chloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-sulfonamide |
| SMILES | C#CCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C15H9ClN2O4S3/c1-2-5-18-9-6-10-11(22-8-21-10)7-12(9)23-15(18)17-25(19,20)14-4-3-13(16)24-14/h1,3-4,6-7H,5,8H2 |
| InChIKey | SHHOZICXGRJSBU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|