C24H17N3O5S2 — CID 121043840
4-(benzenesulfonamido)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide (PubChem CID 121043840) has the molecular formula C24H17N3O5S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
|---|---|
| PubChem CID | 121043840 |
| Molecular Formula | C24H17N3O5S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 4-(benzenesulfonamido)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C24H17N3O5S2/c1-2-12-27-19-13-20-21(32-15-31-20)14-22(19)33-24(27)25-23(28)16-8-10-17(11-9-16)26-34(29,30)18-6-4-3-5-7-18/h1,3-11,13-14,26H,12,15H2/b25-24- |
| InChIKey | SHHLNBVOKCRKKH-IZHYLOQSSA-N |
| XLogP | 3.61 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|