C23H17N3O3S2 — CID 121043797
4-(benzenesulfonamido)-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121043797) has the molecular formula C23H17N3O3S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121043797 |
| Molecular Formula | C23H17N3O3S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 4-(benzenesulfonamido)-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C23H17N3O3S2/c1-2-16-26-20-10-6-7-11-21(20)30-23(26)24-22(27)17-12-14-18(15-13-17)25-31(28,29)19-8-4-3-5-9-19/h1,3-15,25H,16H2/b24-23- |
| InChIKey | SMFOQEYMNCMDDO-VHXPQNKSSA-N |
| XLogP | 3.88 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|