C26H21N3O5S2 — CID 121044187
methyl 2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 121044187) has the molecular formula C26H21N3O5S2 and a molecular weight of 519.60 g/mol. Its IUPAC name is methyl 2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 121044187 |
| Molecular Formula | C26H21N3O5S2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | methyl 2-[4-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C26H21N3O5S2/c1-4-15-29-22-14-9-19(25(31)34-3)16-23(22)35-26(29)27-24(30)18-7-10-20(11-8-18)28-36(32,33)21-12-5-17(2)6-13-21/h1,5-14,16,28H,15H2,2-3H3/b27-26- |
| InChIKey | HUCXJMBAZHRLDN-RQZHXJHFSA-N |
| XLogP | 3.97 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|