C24H18N4O5S2 — CID 121042571
3-[(4-methylphenyl)sulfonylamino]-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121042571) has the molecular formula C24H18N4O5S2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121042571 |
| Molecular Formula | C24H18N4O5S2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C24H18N4O5S2/c1-3-13-27-21-12-9-19(28(30)31)15-22(21)34-24(27)25-23(29)17-5-4-6-18(14-17)26-35(32,33)20-10-7-16(2)8-11-20/h1,4-12,14-15,26H,13H2,2H3/b25-24- |
| InChIKey | UVHZUCQDNYFDSI-IZHYLOQSSA-N |
| XLogP | 4.09 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|