C23H17ClN4O7S2 — CID 121042984
methyl 2-[2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 121042984) has the molecular formula C23H17ClN4O7S2 and a molecular weight of 561.00 g/mol. Its IUPAC name is methyl 2-[2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 121042984 |
| Molecular Formula | C23H17ClN4O7S2 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | methyl 2-[2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(Cl)cc3)c2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H17ClN4O7S2/c1-35-21(29)13-27-19-10-7-17(28(31)32)12-20(19)36-23(27)25-22(30)14-3-2-4-16(11-14)26-37(33,34)18-8-5-15(24)6-9-18/h2-12,26H,13H2,1H3/b25-23- |
| InChIKey | WIRZJDSNZGEURH-BZZOAKBMSA-N |
| XLogP | 3.98 |
| TPSA | 149.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|