C25H18ClN3O5S2 — CID 121043021
methyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 121043021) has the molecular formula C25H18ClN3O5S2 and a molecular weight of 540.02 g/mol. Its IUPAC name is methyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 121043021 |
| Molecular Formula | C25H18ClN3O5S2 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | methyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(Cl)cc3)c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C25H18ClN3O5S2/c1-3-13-29-21-12-7-17(24(31)34-2)15-22(21)35-25(29)27-23(30)16-5-4-6-19(14-16)28-36(32,33)20-10-8-18(26)9-11-20/h1,4-12,14-15,28H,13H2,2H3/b27-25- |
| InChIKey | ILIZUDGSERSJBL-RFBIWTDZSA-N |
| XLogP | 4.32 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|