C27H26ClN3O6S2 — CID 121042959
ethyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 121042959) has the molecular formula C27H26ClN3O6S2 and a molecular weight of 588.11 g/mol. Its IUPAC name is ethyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 121042959 |
| Molecular Formula | C27H26ClN3O6S2 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | ethyl 2-[3-[(4-chlorophenyl)sulfonylamino]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(Cl)cc3)c2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C27H26ClN3O6S2/c1-3-36-15-14-31-23-13-8-19(26(33)37-4-2)17-24(23)38-27(31)29-25(32)18-6-5-7-21(16-18)30-39(34,35)22-11-9-20(28)10-12-22/h5-13,16-17,30H,3-4,14-15H2,1-2H3/b29-27- |
| InChIKey | UDSJLVAUXMEFOF-OHYPFYFLSA-N |
| XLogP | 5.11 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|