C27H23N3O5S2 — CID 121042565
ethyl 2-[3-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 121042565) has the molecular formula C27H23N3O5S2 and a molecular weight of 533.63 g/mol. Its IUPAC name is ethyl 2-[3-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[3-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 121042565 |
| Molecular Formula | C27H23N3O5S2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | ethyl 2-[3-[(4-methylphenyl)sulfonylamino]benzoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C27H23N3O5S2/c1-4-15-30-23-14-11-20(26(32)35-5-2)17-24(23)36-27(30)28-25(31)19-7-6-8-21(16-19)29-37(33,34)22-12-9-18(3)10-13-22/h1,6-14,16-17,29H,5,15H2,2-3H3/b28-27- |
| InChIKey | ORNUUAVTXVMHHK-DQSJHHFOSA-N |
| XLogP | 4.36 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|