C26H23N3O5S2 — CID 121042619
N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 121042619) has the molecular formula C26H23N3O5S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121042619 |
| Molecular Formula | C26H23N3O5S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C26H23N3O5S2/c1-5-13-29-21-15-22(33-3)23(34-4)16-24(21)35-26(29)27-25(30)18-7-6-8-19(14-18)28-36(31,32)20-11-9-17(2)10-12-20/h1,6-12,14-16,28H,13H2,2-4H3/b27-26- |
| InChIKey | AMAYPSLAJSHZSV-RQZHXJHFSA-N |
| XLogP | 4.20 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|