C26H23N3O4S2 — CID 121044195
N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 121044195) has the molecular formula C26H23N3O4S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121044195 |
| Molecular Formula | C26H23N3O4S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C26H23N3O4S2/c1-4-16-29-23-15-12-21(33-5-2)17-24(23)34-26(29)27-25(30)19-8-10-20(11-9-19)28-35(31,32)22-13-6-18(3)7-14-22/h1,6-15,17,28H,5,16H2,2-3H3/b27-26- |
| InChIKey | AGMNJWJKLJKDIV-RQZHXJHFSA-N |
| XLogP | 4.59 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|