C16H13N3O3S3 — CID 41340064
N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide (PubChem CID 41340064) has the molecular formula C16H13N3O3S3 and a molecular weight of 391.50 g/mol. Its IUPAC name is N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide.
| Compound Name | N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 41340064 |
| Molecular Formula | C16H13N3O3S3 |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cc2cccs2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C16H13N3O3S3/c1-2-7-19-13-6-5-12(25(17,21)22)10-14(13)24-16(19)18-15(20)9-11-4-3-8-23-11/h1,3-6,8,10H,7,9H2,(H2,17,21,22)/b18-16- |
| InChIKey | RNFBDBXIZBDTFW-VLGSPTGOSA-N |
| XLogP | 1.71 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|