C23H18N2O3S2 — CID 4526142
N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide (PubChem CID 4526142) has the molecular formula C23H18N2O3S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 4526142 |
| Molecular Formula | C23H18N2O3S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cc2cccc3ccccc23)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H18N2O3S2/c1-3-13-25-20-12-11-18(30(2,27)28)15-21(20)29-23(25)24-22(26)14-17-9-6-8-16-7-4-5-10-19(16)17/h1,4-12,15H,13-14H2,2H3/b24-23- |
| InChIKey | YPOWZJADKPGFMK-VHXPQNKSSA-N |
| XLogP | 3.56 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|