C22H15FN2OS — CID 4247564
N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide (PubChem CID 4247564) has the molecular formula C22H15FN2OS and a molecular weight of 374.44 g/mol. Its IUPAC name is N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 4247564 |
| Molecular Formula | C22H15FN2OS |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cc2cccc3ccccc23)sc2cc(F)ccc21 |
| InChI | InChI=1S/C22H15FN2OS/c1-2-12-25-19-11-10-17(23)14-20(19)27-22(25)24-21(26)13-16-8-5-7-15-6-3-4-9-18(15)16/h1,3-11,14H,12-13H2/b24-22- |
| InChIKey | HIRCIXLPVHYZCK-GYHWCHFESA-N |
| XLogP | 4.30 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|