C24H13FN2O3S — CID 3582438
N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 3582438) has the molecular formula C24H13FN2O3S and a molecular weight of 428.44 g/mol. Its IUPAC name is N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 3582438 |
| Molecular Formula | C24H13FN2O3S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | C#CCn1/c(=N\C(=O)c2cc3c(ccc4ccccc43)oc2=O)sc2cc(F)ccc21 |
| InChI | InChI=1S/C24H13FN2O3S/c1-2-11-27-19-9-8-15(25)12-21(19)31-24(27)26-22(28)18-13-17-16-6-4-3-5-14(16)7-10-20(17)30-23(18)29/h1,3-10,12-13H,11H2/b26-24+ |
| InChIKey | FOJRXOYTHWPARG-SHHOIMCASA-N |
| XLogP | 4.48 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|