C26H22N2O4S — CID 40888246
N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 40888246) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 40888246 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | COCCn1/c(=N/C(=O)c2cc3c(ccc4ccccc43)oc2=O)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C26H22N2O4S/c1-15-12-16(2)23-22(13-15)33-26(28(23)10-11-31-3)27-24(29)20-14-19-18-7-5-4-6-17(18)8-9-21(19)32-25(20)30/h4-9,12-14H,10-11H2,1-3H3/b27-26- |
| InChIKey | HGIPQESNFMZWCI-RQZHXJHFSA-N |
| XLogP | 4.97 |
| TPSA | 73.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|