C27H20N2O7S — CID 3551841
ethyl 3-(2-methoxy-2-oxoethyl)-2-(3-oxobenzo[f]chromene-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate (PubChem CID 3551841) has the molecular formula C27H20N2O7S and a molecular weight of 516.53 g/mol. Its IUPAC name is ethyl 3-(2-methoxy-2-oxoethyl)-2-(3-oxobenzo[f]chromene-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-methoxy-2-oxoethyl)-2-(3-oxobenzo[f]chromene-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3551841 |
| Molecular Formula | C27H20N2O7S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | ethyl 3-(2-methoxy-2-oxoethyl)-2-(3-oxobenzo[f]chromene-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)s/c(=N/C(=O)c1cc3c(ccc4ccccc43)oc1=O)n2CC(=O)OC |
| InChI | InChI=1S/C27H20N2O7S/c1-3-35-25(32)16-8-10-20-22(12-16)37-27(29(20)14-23(30)34-2)28-24(31)19-13-18-17-7-5-4-6-15(17)9-11-21(18)36-26(19)33/h4-13H,3,14H2,1-2H3/b28-27+ |
| InChIKey | RRJPGZUMARBIRC-BYYHNAKLSA-N |
| XLogP | 4.05 |
| TPSA | 117.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|