C22H18N2O7S2 — CID 4138059
ethyl 2-[6-methylsulfonyl-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 4138059) has the molecular formula C22H18N2O7S2 and a molecular weight of 486.53 g/mol. Its IUPAC name is ethyl 2-[6-methylsulfonyl-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-methylsulfonyl-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4138059 |
| Molecular Formula | C22H18N2O7S2 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | ethyl 2-[6-methylsulfonyl-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C22H18N2O7S2/c1-3-30-19(25)12-24-16-9-8-14(33(2,28)29)11-18(16)32-22(24)23-20(26)15-10-13-6-4-5-7-17(13)31-21(15)27/h4-11H,3,12H2,1-2H3/b23-22- |
| InChIKey | MDKKLQSTFPBTTN-FCQUAONHSA-N |
| XLogP | 2.52 |
| TPSA | 125.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|