C20H15FN2O3S — CID 43984891
N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide (PubChem CID 43984891) has the molecular formula C20H15FN2O3S and a molecular weight of 382.42 g/mol. Its IUPAC name is N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide.
| Compound Name | N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 43984891 |
| Molecular Formula | C20H15FN2O3S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
| SMILES | CCCn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cc(F)ccc21 |
| InChI | InChI=1S/C20H15FN2O3S/c1-2-9-23-15-8-7-13(21)11-17(15)27-20(23)22-18(24)14-10-12-5-3-4-6-16(12)26-19(14)25/h3-8,10-11H,2,9H2,1H3/b22-20- |
| InChIKey | SIZRBCGPMBUQSH-XDOYNYLZSA-N |
| XLogP | 4.10 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|