C20H14N2O5S — CID 7154044
N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-2-oxochromene-3-carboxamide (PubChem CID 7154044) has the molecular formula C20H14N2O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-2-oxochromene-3-carboxamide.
| Compound Name | N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7154044 |
| Molecular Formula | C20H14N2O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-(7-ethyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-2-oxochromene-3-carboxamide |
| SMILES | CCn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C20H14N2O5S/c1-2-22-13-8-15-16(26-10-25-15)9-17(13)28-20(22)21-18(23)12-7-11-5-3-4-6-14(11)27-19(12)24/h3-9H,2,10H2,1H3/b21-20- |
| InChIKey | CXKVRDQULFQJJE-MRCUWXFGSA-N |
| XLogP | 3.30 |
| TPSA | 83.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|