C25H16N2O5S — CID 41007124
3-oxo-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzo[f]chromene-2-carboxamide (PubChem CID 41007124) has the molecular formula C25H16N2O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is 3-oxo-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzo[f]chromene-2-carboxamide.
| Compound Name | 3-oxo-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 41007124 |
| Molecular Formula | C25H16N2O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 3-oxo-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzo[f]chromene-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc3c(ccc4ccccc43)oc2=O)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C25H16N2O5S/c1-2-9-27-18-11-20-21(31-13-30-20)12-22(18)33-25(27)26-23(28)17-10-16-15-6-4-3-5-14(15)7-8-19(16)32-24(17)29/h2-8,10-12H,1,9,13H2/b26-25- |
| InChIKey | FTVSITQQLFHYPH-QPLCGJKRSA-N |
| XLogP | 4.62 |
| TPSA | 83.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|