C23H16N2O5S2 — CID 4119279
N-(3-methyl-6-methylsulfonyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 4119279) has the molecular formula C23H16N2O5S2 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-(3-methyl-6-methylsulfonyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(3-methyl-6-methylsulfonyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 4119279 |
| Molecular Formula | C23H16N2O5S2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | N-(3-methyl-6-methylsulfonyl-1,3-benzothiazol-2-ylidene)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | Cn1/c(=N\C(=O)c2cc3c(ccc4ccccc43)oc2=O)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H16N2O5S2/c1-25-18-9-8-14(32(2,28)29)11-20(18)31-23(25)24-21(26)17-12-16-15-6-4-3-5-13(15)7-10-19(16)30-22(17)27/h3-12H,1-2H3/b24-23+ |
| InChIKey | FBIBQZKXKSCROX-WCWDXBQESA-N |
| XLogP | 3.64 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|