C24H19N3O6S2 — CID 4190272
N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 4190272) has the molecular formula C24H19N3O6S2 and a molecular weight of 509.57 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 4190272 |
| Molecular Formula | C24H19N3O6S2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | COCCn1/c(=N\C(=O)c2cc3c(ccc4ccccc43)oc2=O)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C24H19N3O6S2/c1-32-11-10-27-19-8-7-15(35(25,30)31)12-21(19)34-24(27)26-22(28)18-13-17-16-5-3-2-4-14(16)6-9-20(17)33-23(18)29/h2-9,12-13H,10-11H2,1H3,(H2,25,30,31)/b26-24+ |
| InChIKey | UKBBNQQNNLPPBK-SHHOIMCASA-N |
| XLogP | 3.00 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|