C21H20N4O6S2 — CID 3663511
4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 3663511) has the molecular formula C21H20N4O6S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3663511 |
| Molecular Formula | C21H20N4O6S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | COCCn1/c(=N/C(=O)c2ccc(N3C(=O)CCC3=O)cc2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H20N4O6S2/c1-31-11-10-24-16-7-6-15(33(22,29)30)12-17(16)32-21(24)23-20(28)13-2-4-14(5-3-13)25-18(26)8-9-19(25)27/h2-7,12H,8-11H2,1H3,(H2,22,29,30)/b23-21- |
| InChIKey | FFLIVLMGUHIQPO-LNVKXUELSA-N |
| XLogP | 1.39 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|