C21H17Cl2N3O4S — CID 40886532
N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 40886532) has the molecular formula C21H17Cl2N3O4S and a molecular weight of 478.36 g/mol. Its IUPAC name is N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 40886532 |
| Molecular Formula | C21H17Cl2N3O4S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | COCCn1/c(=N/C(=O)c2ccc(N3C(=O)CCC3=O)cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C21H17Cl2N3O4S/c1-30-9-8-25-19-15(23)10-13(22)11-16(19)31-21(25)24-20(29)12-2-4-14(5-3-12)26-17(27)6-7-18(26)28/h2-5,10-11H,6-9H2,1H3/b24-21- |
| InChIKey | YUBOGDHMYPJKLU-FLFQWRMESA-N |
| XLogP | 4.05 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|