C18H14Cl4N2O2S — CID 43939049
3,5-dichloro-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43939049) has the molecular formula C18H14Cl4N2O2S and a molecular weight of 464.20 g/mol. Its IUPAC name is 3,5-dichloro-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 3,5-dichloro-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939049 |
| Molecular Formula | C18H14Cl4N2O2S |
| Molecular Weight | 464.20 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | 3,5-dichloro-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(Cl)cc(Cl)c2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C18H14Cl4N2O2S/c1-2-26-4-3-24-16-14(22)8-13(21)9-15(16)27-18(24)23-17(25)10-5-11(19)7-12(20)6-10/h5-9H,2-4H2,1H3/b23-18- |
| InChIKey | RJCYOHZIIZVIOW-NKFKGCMQSA-N |
| XLogP | 6.09 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.20 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|