C16H13Cl2N3O5S — CID 41202706
N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrofuran-2-carboxamide (PubChem CID 41202706) has the molecular formula C16H13Cl2N3O5S and a molecular weight of 430.27 g/mol. Its IUPAC name is N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 41202706 |
| Molecular Formula | C16H13Cl2N3O5S |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrofuran-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])o2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C16H13Cl2N3O5S/c1-2-25-6-5-20-14-10(18)7-9(17)8-12(14)27-16(20)19-15(22)11-3-4-13(26-11)21(23)24/h3-4,7-8H,2,5-6H2,1H3/b19-16- |
| InChIKey | VMUYIJFVGWTIPB-MNDPQUGUSA-N |
| XLogP | 4.29 |
| TPSA | 99.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|