C18H17N3O7S — CID 4986082
methyl 3-(2-ethoxyethyl)-2-(5-nitrofuran-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate (PubChem CID 4986082) has the molecular formula C18H17N3O7S and a molecular weight of 419.42 g/mol. Its IUPAC name is methyl 3-(2-ethoxyethyl)-2-(5-nitrofuran-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-ethoxyethyl)-2-(5-nitrofuran-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4986082 |
| Molecular Formula | C18H17N3O7S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | methyl 3-(2-ethoxyethyl)-2-(5-nitrofuran-2-carbonyl)imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])o2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C18H17N3O7S/c1-3-27-9-8-20-12-5-4-11(17(23)26-2)10-14(12)29-18(20)19-16(22)13-6-7-15(28-13)21(24)25/h4-7,10H,3,8-9H2,1-2H3/b19-18- |
| InChIKey | XPTKDMWTIXJFSZ-HNENSFHCSA-N |
| XLogP | 2.77 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|