C20H17Cl2N3O4S — CID 43939205
(E)-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 43939205) has the molecular formula C20H17Cl2N3O4S and a molecular weight of 466.35 g/mol. Its IUPAC name is (E)-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43939205 |
| Molecular Formula | C20H17Cl2N3O4S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | (E)-N-[4,6-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCOCCn1/c(=N/C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C20H17Cl2N3O4S/c1-2-29-10-9-24-19-16(22)11-14(21)12-17(19)30-20(24)23-18(26)8-5-13-3-6-15(7-4-13)25(27)28/h3-8,11-12H,2,9-10H2,1H3/b8-5+,23-20- |
| InChIKey | QKECWHKWEJRTAN-OCULNYMISA-N |
| XLogP | 5.09 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|