C17H16N4O6S2 — CID 4694627
N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-nitrobenzamide (PubChem CID 4694627) has the molecular formula C17H16N4O6S2 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-nitrobenzamide.
| Compound Name | N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4694627 |
| Molecular Formula | C17H16N4O6S2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[3-(2-methoxyethyl)-6-sulfamoyl-1,3-benzothiazol-2-ylidene]-3-nitrobenzamide |
| SMILES | COCCn1/c(=N/C(=O)c2cccc([N+](=O)[O-])c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H16N4O6S2/c1-27-8-7-20-14-6-5-13(29(18,25)26)10-15(14)28-17(20)19-16(22)11-3-2-4-12(9-11)21(23)24/h2-6,9-10H,7-8H2,1H3,(H2,18,25,26)/b19-17- |
| InChIKey | BNMFFGSADLQHHZ-ZPHPHTNESA-N |
| XLogP | 1.65 |
| TPSA | 146.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|