C18H11BrN2O3S — CID 42388106
N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide (PubChem CID 42388106) has the molecular formula C18H11BrN2O3S and a molecular weight of 415.27 g/mol. Its IUPAC name is N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide.
| Compound Name | N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 42388106 |
| Molecular Formula | C18H11BrN2O3S |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
| SMILES | Cn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cccc(Br)c21 |
| InChI | InChI=1S/C18H11BrN2O3S/c1-21-15-12(19)6-4-8-14(15)25-18(21)20-16(22)11-9-10-5-2-3-7-13(10)24-17(11)23/h2-9H,1H3/b20-18- |
| InChIKey | ZTTXOJJUHPVNPP-ZZEZOPTASA-N |
| XLogP | 3.85 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|