C20H12Cl2N2O5S — CID 41204819
methyl 2-[4,6-dichloro-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 41204819) has the molecular formula C20H12Cl2N2O5S and a molecular weight of 463.30 g/mol. Its IUPAC name is methyl 2-[4,6-dichloro-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[4,6-dichloro-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204819 |
| Molecular Formula | C20H12Cl2N2O5S |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | methyl 2-[4,6-dichloro-2-(2-oxochromene-3-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C20H12Cl2N2O5S/c1-28-16(25)9-24-17-13(22)7-11(21)8-15(17)30-20(24)23-18(26)12-6-10-4-2-3-5-14(10)29-19(12)27/h2-8H,9H2,1H3/b23-20- |
| InChIKey | GSHTVOLYFTXKIN-ATJXCDBQSA-N |
| XLogP | 4.03 |
| TPSA | 90.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|