C20H13Cl2N3O5S — CID 41204826
methyl 2-[4,6-dichloro-2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 41204826) has the molecular formula C20H13Cl2N3O5S and a molecular weight of 478.31 g/mol. Its IUPAC name is methyl 2-[4,6-dichloro-2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[4,6-dichloro-2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204826 |
| Molecular Formula | C20H13Cl2N3O5S |
| Molecular Weight | 478.31 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | methyl 2-[4,6-dichloro-2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CN2C(=O)c3ccccc3C2=O)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C20H13Cl2N3O5S/c1-30-16(27)9-24-17-13(22)6-10(21)7-14(17)31-20(24)23-15(26)8-25-18(28)11-4-2-3-5-12(11)19(25)29/h2-7H,8-9H2,1H3/b23-20- |
| InChIKey | ZTZQXJJNQPZURM-ATJXCDBQSA-N |
| XLogP | 2.91 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|