C14H15ClN2O3S — CID 7153779
methyl 2-(2-butanoylimino-4-chloro-1,3-benzothiazol-3-yl)acetate (PubChem CID 7153779) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is methyl 2-(2-butanoylimino-4-chloro-1,3-benzothiazol-3-yl)acetate.
| Compound Name | methyl 2-(2-butanoylimino-4-chloro-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 7153779 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | methyl 2-(2-butanoylimino-4-chloro-1,3-benzothiazol-3-yl)acetate |
| SMILES | CCCC(=O)/N=c1\sc2cccc(Cl)c2n1CC(=O)OC |
| InChI | InChI=1S/C14H15ClN2O3S/c1-3-5-11(18)16-14-17(8-12(19)20-2)13-9(15)6-4-7-10(13)21-14/h4,6-7H,3,5,8H2,1-2H3/b16-14- |
| InChIKey | VJNBAPUQYPQQEN-PEZBUJJGSA-N |
| XLogP | 2.76 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |