C19H15ClN2O4S — CID 7153650
methyl 2-[2-(4-acetylbenzoyl)imino-4-chloro-1,3-benzothiazol-3-yl]acetate (PubChem CID 7153650) has the molecular formula C19H15ClN2O4S and a molecular weight of 402.86 g/mol. Its IUPAC name is methyl 2-[2-(4-acetylbenzoyl)imino-4-chloro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-acetylbenzoyl)imino-4-chloro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 7153650 |
| Molecular Formula | C19H15ClN2O4S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | methyl 2-[2-(4-acetylbenzoyl)imino-4-chloro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc(C(C)=O)cc2)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C19H15ClN2O4S/c1-11(23)12-6-8-13(9-7-12)18(25)21-19-22(10-16(24)26-2)17-14(20)4-3-5-15(17)27-19/h3-9H,10H2,1-2H3/b21-19- |
| InChIKey | ATDPHBOREPRDMB-VZCXRCSSSA-N |
| XLogP | 3.47 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |