C25H20N2O5S — CID 41204644
methyl 2-[2-(4-benzoylbenzoyl)imino-4-methoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 41204644) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is methyl 2-[2-(4-benzoylbenzoyl)imino-4-methoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-benzoylbenzoyl)imino-4-methoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204644 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | methyl 2-[2-(4-benzoylbenzoyl)imino-4-methoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc(C(=O)c3ccccc3)cc2)sc2cccc(OC)c21 |
| InChI | InChI=1S/C25H20N2O5S/c1-31-19-9-6-10-20-22(19)27(15-21(28)32-2)25(33-20)26-24(30)18-13-11-17(12-14-18)23(29)16-7-4-3-5-8-16/h3-14H,15H2,1-2H3/b26-25- |
| InChIKey | PRXARDLCTNNFNL-QPLCGJKRSA-N |
| XLogP | 3.86 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |