C16H14N2O2S — CID 4051036
N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4051036) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4051036 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | COc1cccc2s/c(=N\C(=O)c3ccccc3)n(C)c12 |
| InChI | InChI=1S/C16H14N2O2S/c1-18-14-12(20-2)9-6-10-13(14)21-16(18)17-15(19)11-7-4-3-5-8-11/h3-10H,1-2H3/b17-16- |
| InChIKey | ZDZBOSHGRJYIBB-MSUUIHNZSA-N |
| XLogP | 2.99 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |