C21H15FN2O2S — CID 40885648
N-(4-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-phenoxybenzamide (PubChem CID 40885648) has the molecular formula C21H15FN2O2S and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(4-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-phenoxybenzamide.
| Compound Name | N-(4-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-phenoxybenzamide |
|---|---|
| PubChem CID | 40885648 |
| Molecular Formula | C21H15FN2O2S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-(4-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-phenoxybenzamide |
| SMILES | Cn1/c(=N/C(=O)c2ccc(Oc3ccccc3)cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C21H15FN2O2S/c1-24-19-17(22)8-5-9-18(19)27-21(24)23-20(25)14-10-12-16(13-11-14)26-15-6-3-2-4-7-15/h2-13H,1H3/b23-21- |
| InChIKey | JCXVUKUZNITNAT-LNVKXUELSA-N |
| XLogP | 4.91 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |