C23H26N2O5S — CID 41204668
methyl 2-[2-(4-butoxybenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 41204668) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is methyl 2-[2-(4-butoxybenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-butoxybenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204668 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | methyl 2-[2-(4-butoxybenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCCCOc1ccc(C(=O)/N=c2\sc3cccc(OCC)c3n2CC(=O)OC)cc1 |
| InChI | InChI=1S/C23H26N2O5S/c1-4-6-14-30-17-12-10-16(11-13-17)22(27)24-23-25(15-20(26)28-3)21-18(29-5-2)8-7-9-19(21)31-23/h7-13H,4-6,14-15H2,1-3H3/b24-23- |
| InChIKey | BUCQBVSLNFLPEZ-VHXPQNKSSA-N |
| XLogP | 4.19 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|